C17H16N2OS2 — CID 937848
N-(2-ethylsulfanyl-1,3-benzothiazol-6-yl)-4-methylbenzamide (PubChem CID 937848) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-(2-ethylsulfanyl-1,3-benzothiazol-6-yl)-4-methylbenzamide.
| Compound Name | N-(2-ethylsulfanyl-1,3-benzothiazol-6-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 937848 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-(2-ethylsulfanyl-1,3-benzothiazol-6-yl)-4-methylbenzamide |
| SMILES | CCSc1nc2ccc(NC(=O)c3ccc(C)cc3)cc2s1 |
| InChI | InChI=1S/C17H16N2OS2/c1-3-21-17-19-14-9-8-13(10-15(14)22-17)18-16(20)12-6-4-11(2)5-7-12/h4-10H,3H2,1-2H3,(H,18,20) |
| InChIKey | UCJRRQUTGJKFRD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |