C40H28N4O5S3 — CID 126001240
2-[2-[5-[[1,3-bis(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione (PubChem CID 126001240) has the molecular formula C40H28N4O5S3 and a molecular weight of 740.89 g/mol. Its IUPAC name is 2-[2-[5-[[1,3-bis(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-[5-[[1,3-bis(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 126001240 |
| Molecular Formula | C40H28N4O5S3 |
| Molecular Weight | 740.89 g/mol |
| Exact Mass | 740.12 |
| IUPAC Name | 2-[2-[5-[[1,3-bis(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)C(=Cc3ccc(Sc4nc5ccc(N6C(=O)c7ccccc7C6=O)cc5s4)o3)C(=O)N(c3ccc(C)c(C)c3)C2=S)cc1C |
| InChI | InChI=1S/C40H28N4O5S3/c1-21-9-11-25(17-23(21)3)43-37(47)31(38(48)44(40(43)50)26-12-10-22(2)24(4)18-26)20-28-14-16-34(49-28)52-39-41-32-15-13-27(19-33(32)51-39)42-35(45)29-7-5-6-8-30(29)36(42)46/h5-20H,1-4H3 |
| InChIKey | ZZFXFKAUFSQHPS-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.89 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|