C30H16N4O6S3 — CID 137035842
3-[[(5Z)-5-[[5-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 137035842) has the molecular formula C30H16N4O6S3 and a molecular weight of 624.68 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[5-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[[5-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 137035842 |
| Molecular Formula | C30H16N4O6S3 |
| Molecular Weight | 624.68 g/mol |
| Exact Mass | 624.02 |
| IUPAC Name | 3-[[(5Z)-5-[[5-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | O=C1N/C(=N\c2cccc(C(=O)O)c2)S/C1=C\c1ccc(Sc2nc3ccc(N4C(=O)c5ccccc5C4=O)cc3s2)o1 |
| InChI | InChI=1S/C30H16N4O6S3/c35-25-23(41-29(33-25)31-16-5-3-4-15(12-16)28(38)39)14-18-9-11-24(40-18)43-30-32-21-10-8-17(13-22(21)42-30)34-26(36)19-6-1-2-7-20(19)27(34)37/h1-14H,(H,38,39)(H,31,33,35)/b23-14- |
| InChIKey | FAGCQFYGSGMUCX-UCQKPKSFSA-N |
| XLogP | 6.43 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|