C22H14ClN3O2S3 — CID 137162385
(5Z)-5-[[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylidene]-2-(4-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137162385) has the molecular formula C22H14ClN3O2S3 and a molecular weight of 484.03 g/mol. Its IUPAC name is (5Z)-5-[[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylidene]-2-(4-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylidene]-2-(4-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137162385 |
| Molecular Formula | C22H14ClN3O2S3 |
| Molecular Weight | 484.03 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | (5Z)-5-[[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylidene]-2-(4-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(Cl)ccc1/N=C1\NC(=O)/C(=C/c2ccc(Sc3nc4ccccc4s3)o2)S1 |
| InChI | InChI=1S/C22H14ClN3O2S3/c1-12-10-13(23)6-8-15(12)24-21-26-20(27)18(29-21)11-14-7-9-19(28-14)31-22-25-16-4-2-3-5-17(16)30-22/h2-11H,1H3,(H,24,26,27)/b18-11- |
| InChIKey | NCJHEZWMJNBIAH-WQRHYEAKSA-N |
| XLogP | 6.89 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.03 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|