C30H18N4O4S3 — CID 137035886
2-[2-[5-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione (PubChem CID 137035886) has the molecular formula C30H18N4O4S3 and a molecular weight of 594.70 g/mol. Its IUPAC name is 2-[2-[5-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-[5-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 137035886 |
| Molecular Formula | C30H18N4O4S3 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.05 |
| IUPAC Name | 2-[2-[5-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3ccc(Sc4nc5ccc(N6C(=O)c7ccccc7C6=O)cc5s4)o3)S2)cc1 |
| InChI | InChI=1S/C30H18N4O4S3/c1-16-6-8-17(9-7-16)31-29-33-26(35)24(39-29)15-19-11-13-25(38-19)41-30-32-22-12-10-18(14-23(22)40-30)34-27(36)20-4-2-3-5-21(20)28(34)37/h2-15H,1H3,(H,31,33,35)/b24-15- |
| InChIKey | HDOJHMFDPSPVPO-IWIPYMOSSA-N |
| XLogP | 7.04 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|