C24H20N4O3S2 — CID 137139085
(5E)-2-(4-ethoxyphenyl)imino-5-[[5-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137139085) has the molecular formula C24H20N4O3S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is (5E)-2-(4-ethoxyphenyl)imino-5-[[5-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-ethoxyphenyl)imino-5-[[5-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137139085 |
| Molecular Formula | C24H20N4O3S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | (5E)-2-(4-ethoxyphenyl)imino-5-[[5-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(/N=C2/NC(=O)/C(=C\c3ccc(Sc4nc5ccc(C)cc5[nH]4)o3)S2)cc1 |
| InChI | InChI=1S/C24H20N4O3S2/c1-3-30-16-7-5-15(6-8-16)25-23-28-22(29)20(32-23)13-17-9-11-21(31-17)33-24-26-18-10-4-14(2)12-19(18)27-24/h4-13H,3H2,1-2H3,(H,26,27)(H,25,28,29)/b20-13+ |
| InChIKey | CTQZPJJPWSPNPO-DEDYPNTBSA-N |
| XLogP | 5.91 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|