C22H14N4O4S3 — CID 137036173
(5Z)-2-(4-methylphenyl)imino-5-[[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137036173) has the molecular formula C22H14N4O4S3 and a molecular weight of 494.58 g/mol. Its IUPAC name is (5Z)-2-(4-methylphenyl)imino-5-[[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-methylphenyl)imino-5-[[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137036173 |
| Molecular Formula | C22H14N4O4S3 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | (5Z)-2-(4-methylphenyl)imino-5-[[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3ccc(Sc4nc5ccc([N+](=O)[O-])cc5s4)o3)S2)cc1 |
| InChI | InChI=1S/C22H14N4O4S3/c1-12-2-4-13(5-3-12)23-21-25-20(27)18(31-21)11-15-7-9-19(30-15)33-22-24-16-8-6-14(26(28)29)10-17(16)32-22/h2-11H,1H3,(H,23,25,27)/b18-11- |
| InChIKey | UXXRRYFOZONDRE-WQRHYEAKSA-N |
| XLogP | 6.15 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|