C31H20N4O4S3 — CID 137035902
2-[2-[5-[(Z)-[2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione (PubChem CID 137035902) has the molecular formula C31H20N4O4S3 and a molecular weight of 608.73 g/mol. Its IUPAC name is 2-[2-[5-[(Z)-[2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-[5-[(Z)-[2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 137035902 |
| Molecular Formula | C31H20N4O4S3 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.06 |
| IUPAC Name | 2-[2-[5-[(Z)-[2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3ccc(Sc4nc5ccc(N6C(=O)c7ccccc7C6=O)cc5s4)o3)S2)c(C)c1 |
| InChI | InChI=1S/C31H20N4O4S3/c1-16-7-10-22(17(2)13-16)32-30-34-27(36)25(40-30)15-19-9-12-26(39-19)42-31-33-23-11-8-18(14-24(23)41-31)35-28(37)20-5-3-4-6-21(20)29(35)38/h3-15H,1-2H3,(H,32,34,36)/b25-15- |
| InChIKey | HUHJYIBSBHMWTK-MYYYXRDXSA-N |
| XLogP | 7.35 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|