C21H12Cl2N4O2S2 — CID 135696917
(5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135696917) has the molecular formula C21H12Cl2N4O2S2 and a molecular weight of 487.39 g/mol. Its IUPAC name is (5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135696917 |
| Molecular Formula | C21H12Cl2N4O2S2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | (5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2cccc(Cl)c2Cl)S/C1=C\c1ccc(Sc2nc3ccccc3[nH]2)o1 |
| InChI | InChI=1S/C21H12Cl2N4O2S2/c22-12-4-3-7-15(18(12)23)26-21-27-19(28)16(30-21)10-11-8-9-17(29-11)31-20-24-13-5-1-2-6-14(13)25-20/h1-10H,(H,24,25)(H,26,27,28)/b16-10- |
| InChIKey | QNPHKJCQQJZFJG-YBEGLDIGSA-N |
| XLogP | 6.51 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|