C20H13ClN2O2S2 — CID 135437461
5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 135437461) has the molecular formula C20H13ClN2O2S2 and a molecular weight of 412.92 g/mol. Its IUPAC name is 5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135437461 |
| Molecular Formula | C20H13ClN2O2S2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccccc2)SC1=Cc1ccc(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C20H13ClN2O2S2/c21-13-6-9-16(10-7-13)26-18-11-8-15(25-18)12-17-19(24)23-20(27-17)22-14-4-2-1-3-5-14/h1-12H,(H,22,23,24) |
| InChIKey | VFCFGAJVMSPPKU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|