C17H9F3N4O3S2 — CID 135810675
(5Z)-2-phenylimino-5-[[5-[[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135810675) has the molecular formula C17H9F3N4O3S2 and a molecular weight of 438.41 g/mol. Its IUPAC name is (5Z)-2-phenylimino-5-[[5-[[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-phenylimino-5-[[5-[[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135810675 |
| Molecular Formula | C17H9F3N4O3S2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | (5Z)-2-phenylimino-5-[[5-[[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccccc2)S/C1=C\c1ccc(Sc2nnc(C(F)(F)F)o2)o1 |
| InChI | InChI=1S/C17H9F3N4O3S2/c18-17(19,20)14-23-24-16(27-14)29-12-7-6-10(26-12)8-11-13(25)22-15(28-11)21-9-4-2-1-3-5-9/h1-8H,(H,21,22,25)/b11-8- |
| InChIKey | YPEKFAOFYAGEFS-FLIBITNWSA-N |
| XLogP | 4.72 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|