C22H16N6O2S2 — CID 137036107
(5Z)-2-(3-methylphenyl)imino-5-[[5-(1-phenyltetrazol-5-yl)sulfanylfuran-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137036107) has the molecular formula C22H16N6O2S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is (5Z)-2-(3-methylphenyl)imino-5-[[5-(1-phenyltetrazol-5-yl)sulfanylfuran-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-methylphenyl)imino-5-[[5-(1-phenyltetrazol-5-yl)sulfanylfuran-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137036107 |
| Molecular Formula | C22H16N6O2S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (5Z)-2-(3-methylphenyl)imino-5-[[5-(1-phenyltetrazol-5-yl)sulfanylfuran-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(/N=C2\NC(=O)/C(=C/c3ccc(Sc4nnnn4-c4ccccc4)o3)S2)c1 |
| InChI | InChI=1S/C22H16N6O2S2/c1-14-6-5-7-15(12-14)23-21-24-20(29)18(31-21)13-17-10-11-19(30-17)32-22-25-26-27-28(22)16-8-3-2-4-9-16/h2-13H,1H3,(H,23,24,29)/b18-13- |
| InChIKey | RVUHTJMPPYAWHS-AQTBWJFISA-N |
| XLogP | 4.61 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|