C14H10N8OS — CID 5347293
(E)-1-[5-(1-phenyltetrazol-5-yl)sulfanylfuran-2-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5347293) has the molecular formula C14H10N8OS and a molecular weight of 338.36 g/mol. Its IUPAC name is (E)-1-[5-(1-phenyltetrazol-5-yl)sulfanylfuran-2-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-[5-(1-phenyltetrazol-5-yl)sulfanylfuran-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5347293 |
| Molecular Formula | C14H10N8OS |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (E)-1-[5-(1-phenyltetrazol-5-yl)sulfanylfuran-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | C(=N/n1cnnc1)\c1ccc(Sc2nnnn2-c2ccccc2)o1 |
| InChI | InChI=1S/C14H10N8OS/c1-2-4-11(5-3-1)22-14(18-19-20-22)24-13-7-6-12(23-13)8-17-21-9-15-16-10-21/h1-10H/b17-8+ |
| InChIKey | PLHGWBMOVBTDBN-CAOOACKPSA-N |
| XLogP | 1.88 |
| TPSA | 99.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|