C12H5F3N4O4S2 — CID 21234037
2-sulfanylidene-5-[[5-[[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-diazinane-4,6-dione (PubChem CID 21234037) has the molecular formula C12H5F3N4O4S2 and a molecular weight of 390.32 g/mol. Its IUPAC name is 2-sulfanylidene-5-[[5-[[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-diazinane-4,6-dione.
| Compound Name | 2-sulfanylidene-5-[[5-[[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 21234037 |
| Molecular Formula | C12H5F3N4O4S2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 2-sulfanylidene-5-[[5-[[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1ccc(Sc2nnc(C(F)(F)F)o2)o1 |
| InChI | InChI=1S/C12H5F3N4O4S2/c13-12(14,15)9-18-19-11(23-9)25-6-2-1-4(22-6)3-5-7(20)16-10(24)17-8(5)21/h1-3H,(H2,16,17,20,21,24) |
| InChIKey | KVURZCAYFNNMEZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|