C9H5N2NaO6S2 — CID 23676672
sodium 5-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]furan-2-sulfonate (PubChem CID 23676672) has the molecular formula C9H5N2NaO6S2 and a molecular weight of 324.27 g/mol. Its IUPAC name is sodium 5-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]furan-2-sulfonate.
| Compound Name | sodium 5-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 23676672 |
| Molecular Formula | C9H5N2NaO6S2 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | sodium 5-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]furan-2-sulfonate |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1ccc(S(=O)(=O)[O-])o1.[Na+] |
| InChI | InChI=1S/C9H6N2O6S2.Na/c12-7-5(8(13)11-9(18)10-7)3-4-1-2-6(17-4)19(14,15)16;/h1-3H,(H,14,15,16)(H2,10,11,12,13,18);/q;+1/p-1 |
| InChIKey | GXOSRPJQVIPAHO-UHFFFAOYSA-M |
| XLogP | -3.90 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|