C15H12N4O4S — CID 126153916
5-[[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126153916) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is 5-[[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126153916 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 5-[[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cc(C)nc(Sc2ccc(C=C3C(=O)NC(=O)NC3=O)o2)n1 |
| InChI | InChI=1S/C15H12N4O4S/c1-7-5-8(2)17-15(16-7)24-11-4-3-9(23-11)6-10-12(20)18-14(22)19-13(10)21/h3-6H,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | YXZHNPSVLZCZJW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|