C15H9N3O6S — CID 10237093
2-[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]sulfanylpyridine-3-carboxylic acid (PubChem CID 10237093) has the molecular formula C15H9N3O6S and a molecular weight of 359.32 g/mol. Its IUPAC name is 2-[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]sulfanylpyridine-3-carboxylic acid.
| Compound Name | 2-[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]sulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 10237093 |
| Molecular Formula | C15H9N3O6S |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 2-[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]sulfanylpyridine-3-carboxylic acid |
| SMILES | O=C1NC(=O)C(=Cc2ccc(Sc3ncccc3C(=O)O)o2)C(=O)N1 |
| InChI | InChI=1S/C15H9N3O6S/c19-11-9(12(20)18-15(23)17-11)6-7-3-4-10(24-7)25-13-8(14(21)22)2-1-5-16-13/h1-6H,(H,21,22)(H2,17,18,19,20,23) |
| InChIKey | WLGKIWHNMCFHIR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|