C9H11NO2S2 — CID 86193847
2-(propyldisulfanyl)pyridine-3-carboxylic acid (PubChem CID 86193847) has the molecular formula C9H11NO2S2 and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-(propyldisulfanyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(propyldisulfanyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 86193847 |
| Molecular Formula | C9H11NO2S2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 2-(propyldisulfanyl)pyridine-3-carboxylic acid |
| SMILES | CCCSSc1ncccc1C(=O)O |
| InChI | InChI=1S/C9H11NO2S2/c1-2-6-13-14-8-7(9(11)12)4-3-5-10-8/h3-5H,2,6H2,1H3,(H,11,12) |
| InChIKey | YBEGOXANVXEOKK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|