C10H9NO2S — CID 24691069
2-but-3-ynylsulfanylpyridine-3-carboxylic acid (PubChem CID 24691069) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-but-3-ynylsulfanylpyridine-3-carboxylic acid.
| Compound Name | 2-but-3-ynylsulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 24691069 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 2-but-3-ynylsulfanylpyridine-3-carboxylic acid |
| SMILES | C#CCCSc1ncccc1C(=O)O |
| InChI | InChI=1S/C10H9NO2S/c1-2-3-7-14-9-8(10(12)13)5-4-6-11-9/h1,4-6H,3,7H2,(H,12,13) |
| InChIKey | GWIYKASBNYGCLD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|