C14H12N2O4S — CID 63062958
2-[2-(2-nitrophenyl)ethylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 63062958) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 2-[2-(2-nitrophenyl)ethylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[2-(2-nitrophenyl)ethylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63062958 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-[2-(2-nitrophenyl)ethylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SCCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N2O4S/c17-14(18)11-5-3-8-15-13(11)21-9-7-10-4-1-2-6-12(10)16(19)20/h1-6,8H,7,9H2,(H,17,18) |
| InChIKey | UPSNNBHJFFPSEP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|