C10H7N3O3S — CID 114570693
2-[(2-oxo-1H-pyrazin-3-yl)sulfanyl]pyridine-3-carboxylic acid (PubChem CID 114570693) has the molecular formula C10H7N3O3S and a molecular weight of 249.25 g/mol. Its IUPAC name is 2-[(2-oxo-1H-pyrazin-3-yl)sulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[(2-oxo-1H-pyrazin-3-yl)sulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114570693 |
| Molecular Formula | C10H7N3O3S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-[(2-oxo-1H-pyrazin-3-yl)sulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1Sc1ncc[nH]c1=O |
| InChI | InChI=1S/C10H7N3O3S/c14-7-9(13-5-4-11-7)17-8-6(10(15)16)2-1-3-12-8/h1-5H,(H,11,14)(H,15,16) |
| InChIKey | IEIFGSMVWVVUJO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |