2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid

C12H11N3O2S — CID 65416667

IUPAC2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid
SMILESCc1cnc(C)c(Sc2ncccc2C(=O)O)n1
InChIInChI=1S/C12H11N3O2S/c1-7-6-14-8(2)10(15-7)18-11-9(12(16)17)4-3-5-13-11/h3-6H,1-2H3,(H,16,17)
InChIKeyLMZCGQNDYVIYCB-UHFFFAOYSA-N
MW261.31 g/mol
LogP2.34
Rot. Bonds3

About 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid

2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid (PubChem CID 65416667) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid
PubChem CID65416667
Molecular FormulaC12H11N3O2S
Molecular Weight261.31 g/mol
Exact Mass261.06
IUPAC Name2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid
SMILESCc1cnc(C)c(Sc2ncccc2C(=O)O)n1
InChIInChI=1S/C12H11N3O2S/c1-7-6-14-8(2)10(15-7)18-11-9(12(16)17)4-3-5-13-11/h3-6H,1-2H3,(H,16,17)
InChIKeyLMZCGQNDYVIYCB-UHFFFAOYSA-N
XLogP2.34
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.31
LogP ≤ 52.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid?
The IUPAC name of 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid (CID 65416667) is 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid.
What is the SMILES notation for 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid?
The canonical SMILES for 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid is Cc1cnc(C)c(Sc2ncccc2C(=O)O)n1.
What is the InChIKey of 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid?
The InChIKey is LMZCGQNDYVIYCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2S/c1-7-6-14-8(2)10(15-7)18-11-9(12(16)17)4-3-5-13-11/h3-6H,1-2H3,(H,16,17).
What are the key properties of 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid?
2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid has a molecular weight of 261.31 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dimethylpyrazin-2-yl)sulfanylpyridine-3-carboxylic acid is sourced from PubChem (CID 65416667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).