About 2-methylpyridine-3-carboxylic acid;hydroiodide
2-methylpyridine-3-carboxylic acid;hydroiodide (PubChem CID 70394156) has the molecular formula C7H8INO2
and a molecular weight of 265.05 g/mol. Its IUPAC name is 2-methylpyridine-3-carboxylic acid;hydroiodide.
Molecular Properties
| Compound Name | 2-methylpyridine-3-carboxylic acid;hydroiodide |
| PubChem CID | 70394156 |
| Molecular Formula | C7H8INO2 |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 264.96 |
| IUPAC Name | 2-methylpyridine-3-carboxylic acid;hydroiodide |
| SMILES | Cc1ncccc1C(=O)O.I |
| InChI | InChI=1S/C7H7NO2.HI/c1-5-6(7(9)10)3-2-4-8-5;/h2-4H,1H3,(H,9,10);1H |
| InChIKey | ABEWTYVKWDUXQB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpyridine-3-carboxylic acid;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyridine-3-carboxylic acid;hydroiodide?
The IUPAC name of 2-methylpyridine-3-carboxylic acid;hydroiodide (CID 70394156) is 2-methylpyridine-3-carboxylic acid;hydroiodide.
What is the SMILES notation for 2-methylpyridine-3-carboxylic acid;hydroiodide?
The canonical SMILES for 2-methylpyridine-3-carboxylic acid;hydroiodide is Cc1ncccc1C(=O)O.I.
What is the InChIKey of 2-methylpyridine-3-carboxylic acid;hydroiodide?
The InChIKey is ABEWTYVKWDUXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.HI/c1-5-6(7(9)10)3-2-4-8-5;/h2-4H,1H3,(H,9,10);1H.
What are the key properties of 2-methylpyridine-3-carboxylic acid;hydroiodide?
2-methylpyridine-3-carboxylic acid;hydroiodide has a molecular weight of 265.05 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyridine-3-carboxylic acid;hydroiodide is sourced from PubChem (CID 70394156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).