C11H7ClN2O3S — CID 114570716
2-chloro-5-[(2-oxo-1H-pyrazin-3-yl)sulfanyl]benzoic acid (PubChem CID 114570716) has the molecular formula C11H7ClN2O3S and a molecular weight of 282.71 g/mol. Its IUPAC name is 2-chloro-5-[(2-oxo-1H-pyrazin-3-yl)sulfanyl]benzoic acid.
| Compound Name | 2-chloro-5-[(2-oxo-1H-pyrazin-3-yl)sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 114570716 |
| Molecular Formula | C11H7ClN2O3S |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 2-chloro-5-[(2-oxo-1H-pyrazin-3-yl)sulfanyl]benzoic acid |
| SMILES | O=C(O)c1cc(Sc2ncc[nH]c2=O)ccc1Cl |
| InChI | InChI=1S/C11H7ClN2O3S/c12-8-2-1-6(5-7(8)11(16)17)18-10-9(15)13-3-4-14-10/h1-5H,(H,13,15)(H,16,17) |
| InChIKey | WTRMQTUKIZSTJS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |