C11H7F3N2O2S — CID 114001043
4-(1H-imidazol-2-ylsulfanyl)-2-(trifluoromethyl)benzoic acid (PubChem CID 114001043) has the molecular formula C11H7F3N2O2S and a molecular weight of 288.25 g/mol. Its IUPAC name is 4-(1H-imidazol-2-ylsulfanyl)-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(1H-imidazol-2-ylsulfanyl)-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 114001043 |
| Molecular Formula | C11H7F3N2O2S |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-(1H-imidazol-2-ylsulfanyl)-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(Sc2ncc[nH]2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H7F3N2O2S/c12-11(13,14)8-5-6(1-2-7(8)9(17)18)19-10-15-3-4-16-10/h1-5H,(H,15,16)(H,17,18) |
| InChIKey | GWGGXRWNABDTNT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |