C10H8ClN3O4S — CID 55212179
2-chloro-5-(1H-imidazol-2-ylsulfamoyl)benzoic acid (PubChem CID 55212179) has the molecular formula C10H8ClN3O4S and a molecular weight of 301.71 g/mol. Its IUPAC name is 2-chloro-5-(1H-imidazol-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2-chloro-5-(1H-imidazol-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 55212179 |
| Molecular Formula | C10H8ClN3O4S |
| Molecular Weight | 301.71 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2-chloro-5-(1H-imidazol-2-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ncc[nH]2)ccc1Cl |
| InChI | InChI=1S/C10H8ClN3O4S/c11-8-2-1-6(5-7(8)9(15)16)19(17,18)14-10-12-3-4-13-10/h1-5H,(H,15,16)(H2,12,13,14) |
| InChIKey | WYMSYBQFLVUAQG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.71 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |