C12H12ClN3O4S — CID 104617545
2-chloro-5-[(4,5-dimethyl-1H-pyrazol-3-yl)sulfamoyl]benzoic acid (PubChem CID 104617545) has the molecular formula C12H12ClN3O4S and a molecular weight of 329.77 g/mol. Its IUPAC name is 2-chloro-5-[(4,5-dimethyl-1H-pyrazol-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-5-[(4,5-dimethyl-1H-pyrazol-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 104617545 |
| Molecular Formula | C12H12ClN3O4S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 2-chloro-5-[(4,5-dimethyl-1H-pyrazol-3-yl)sulfamoyl]benzoic acid |
| SMILES | Cc1[nH]nc(NS(=O)(=O)c2ccc(Cl)c(C(=O)O)c2)c1C |
| InChI | InChI=1S/C12H12ClN3O4S/c1-6-7(2)14-15-11(6)16-21(19,20)8-3-4-10(13)9(5-8)12(17)18/h3-5H,1-2H3,(H,17,18)(H2,14,15,16) |
| InChIKey | YQJXYCBOSTZXJN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |