C13H13F2N3O4S — CID 167939833
4-[[3-(difluoromethyl)-5-methyl-1H-pyrazol-4-yl]sulfamoyl]-2-methylbenzoic acid (PubChem CID 167939833) has the molecular formula C13H13F2N3O4S and a molecular weight of 345.33 g/mol. Its IUPAC name is 4-[[3-(difluoromethyl)-5-methyl-1H-pyrazol-4-yl]sulfamoyl]-2-methylbenzoic acid.
| Compound Name | 4-[[3-(difluoromethyl)-5-methyl-1H-pyrazol-4-yl]sulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 167939833 |
| Molecular Formula | C13H13F2N3O4S |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 4-[[3-(difluoromethyl)-5-methyl-1H-pyrazol-4-yl]sulfamoyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2c(C(F)F)n[nH]c2C)ccc1C(=O)O |
| InChI | InChI=1S/C13H13F2N3O4S/c1-6-5-8(3-4-9(6)13(19)20)23(21,22)18-10-7(2)16-17-11(10)12(14)15/h3-5,12,18H,1-2H3,(H,16,17)(H,19,20) |
| InChIKey | RSWJDLMNQFAMFX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |