C14H10ClF2NO4S — CID 71870168
2-chloro-4-[[3-(difluoromethyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 71870168) has the molecular formula C14H10ClF2NO4S and a molecular weight of 361.75 g/mol. Its IUPAC name is 2-chloro-4-[[3-(difluoromethyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-4-[[3-(difluoromethyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 71870168 |
| Molecular Formula | C14H10ClF2NO4S |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 2-chloro-4-[[3-(difluoromethyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2cccc(C(F)F)c2)cc1Cl |
| InChI | InChI=1S/C14H10ClF2NO4S/c15-12-7-10(4-5-11(12)14(19)20)23(21,22)18-9-3-1-2-8(6-9)13(16)17/h1-7,13,18H,(H,19,20) |
| InChIKey | MMQOKDOPTPKFCR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |