C11H14ClNO5S2 — CID 104656097
2-chloro-4-(2-methylsulfinylpropylsulfamoyl)benzoic acid (PubChem CID 104656097) has the molecular formula C11H14ClNO5S2 and a molecular weight of 339.82 g/mol. Its IUPAC name is 2-chloro-4-(2-methylsulfinylpropylsulfamoyl)benzoic acid.
| Compound Name | 2-chloro-4-(2-methylsulfinylpropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 104656097 |
| Molecular Formula | C11H14ClNO5S2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2-chloro-4-(2-methylsulfinylpropylsulfamoyl)benzoic acid |
| SMILES | CC(CNS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1)S(C)=O |
| InChI | InChI=1S/C11H14ClNO5S2/c1-7(19(2)16)6-13-20(17,18)8-3-4-9(11(14)15)10(12)5-8/h3-5,7,13H,6H2,1-2H3,(H,14,15) |
| InChIKey | MSNRAXLVZNOBQG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |