C14H8ClNO3S2 — CID 6529363
(5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 6529363) has the molecular formula C14H8ClNO3S2 and a molecular weight of 337.81 g/mol. Its IUPAC name is (5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6529363 |
| Molecular Formula | C14H8ClNO3S2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | (5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc(Sc3ccc(Cl)cc3)o2)S1 |
| InChI | InChI=1S/C14H8ClNO3S2/c15-8-1-4-10(5-2-8)20-12-6-3-9(19-12)7-11-13(17)16-14(18)21-11/h1-7H,(H,16,17,18)/b11-7+ |
| InChIKey | PFGXHKQXESWGLH-YRNVUSSQSA-N |
| XLogP | 4.41 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|