C14H8NO3SY- — CID 59987928
(5Z)-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione;yttrium (PubChem CID 59987928) has the molecular formula C14H8NO3SY- and a molecular weight of 359.20 g/mol. Its IUPAC name is (5Z)-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione;yttrium.
| Compound Name | (5Z)-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione;yttrium |
|---|---|
| PubChem CID | 59987928 |
| Molecular Formula | C14H8NO3SY- |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 358.93 |
| IUPAC Name | (5Z)-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione;yttrium |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(-c3c[c-]ccc3)o2)S1.[Y] |
| InChI | InChI=1S/C14H8NO3S.Y/c16-13-12(19-14(17)15-13)8-10-6-7-11(18-10)9-4-2-1-3-5-9;/h1-2,4-8H,(H,15,16,17);/q-1;/b12-8-; |
| InChIKey | GIBCGTYXVZTULE-JCTPKUEWSA-N |
| XLogP | 3.07 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|