C15H12N4O2S — CID 135207995
(5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]imidazolidin-4-one (PubChem CID 135207995) has the molecular formula C15H12N4O2S and a molecular weight of 312.35 g/mol. Its IUPAC name is (5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]imidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]imidazolidin-4-one |
|---|---|
| PubChem CID | 135207995 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]imidazolidin-4-one |
| SMILES | O=C1NCN/C1=C\c1ccc(Sc2nc3ccccc3[nH]2)o1 |
| InChI | InChI=1S/C15H12N4O2S/c20-14-12(16-8-17-14)7-9-5-6-13(21-9)22-15-18-10-3-1-2-4-11(10)19-15/h1-7,16H,8H2,(H,17,20)(H,18,19)/b12-7- |
| InChIKey | AQFWHBHWGCOEQM-GHXNOFRVSA-N |
| XLogP | 2.32 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|