C25H21N5O4S2 — CID 135207988
N-(2-anilinoethyl)-2-[(5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 135207988) has the molecular formula C25H21N5O4S2 and a molecular weight of 519.61 g/mol. Its IUPAC name is N-(2-anilinoethyl)-2-[(5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2-anilinoethyl)-2-[(5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 135207988 |
| Molecular Formula | C25H21N5O4S2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | N-(2-anilinoethyl)-2-[(5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(Sc3nc4ccccc4[nH]3)o2)C1=O)NCCNc1ccccc1 |
| InChI | InChI=1S/C25H21N5O4S2/c31-21(27-13-12-26-16-6-2-1-3-7-16)15-30-23(32)20(35-25(30)33)14-17-10-11-22(34-17)36-24-28-18-8-4-5-9-19(18)29-24/h1-11,14,26H,12-13,15H2,(H,27,31)(H,28,29)/b20-14- |
| InChIKey | KGUWOILQRKHYFC-ZHZULCJRSA-N |
| XLogP | 4.57 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|