C20H17N3O5S2 — CID 121395557
methyl 2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanyl-3H-benzimidazole-5-carboxylate (PubChem CID 121395557) has the molecular formula C20H17N3O5S2 and a molecular weight of 443.51 g/mol. Its IUPAC name is methyl 2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanyl-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanyl-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 121395557 |
| Molecular Formula | C20H17N3O5S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | methyl 2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanyl-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(Sc3ccc(/C=C4\SC(=O)N(C(C)C)C4=O)o3)[nH]c2c1 |
| InChI | InChI=1S/C20H17N3O5S2/c1-10(2)23-17(24)15(29-20(23)26)9-12-5-7-16(28-12)30-19-21-13-6-4-11(18(25)27-3)8-14(13)22-19/h4-10H,1-3H3,(H,21,22)/b15-9- |
| InChIKey | NNBGAJWKVDTIBX-DHDCSXOGSA-N |
| XLogP | 4.54 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|