C21H21NO5S — CID 5079358
methyl 4-[5-[(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate (PubChem CID 5079358) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is methyl 4-[5-[(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[5-[(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 5079358 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | methyl 4-[5-[(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate |
| SMILES | CCC(C)N1C(=O)SC(=Cc2ccc(-c3ccc(C(=O)OC)cc3C)o2)C1=O |
| InChI | InChI=1S/C21H21NO5S/c1-5-13(3)22-19(23)18(28-21(22)25)11-15-7-9-17(27-15)16-8-6-14(10-12(16)2)20(24)26-4/h6-11,13H,5H2,1-4H3 |
| InChIKey | OGYDCJFUXPSLAM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|