C19H16N2O3S2 — CID 158257308
5-[[5-(3H-indol-2-ylsulfanyl)furan-2-yl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione (PubChem CID 158257308) has the molecular formula C19H16N2O3S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 5-[[5-(3H-indol-2-ylsulfanyl)furan-2-yl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-(3H-indol-2-ylsulfanyl)furan-2-yl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 158257308 |
| Molecular Formula | C19H16N2O3S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 5-[[5-(3H-indol-2-ylsulfanyl)furan-2-yl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)SC(=Cc2ccc(SC3=Nc4ccccc4C3)o2)C1=O |
| InChI | InChI=1S/C19H16N2O3S2/c1-11(2)21-18(22)15(25-19(21)23)10-13-7-8-17(24-13)26-16-9-12-5-3-4-6-14(12)20-16/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | SJLJZMPUQOZLCE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|