C19H18N2O3S2 — CID 162118981
ethane;(5Z)-5-[[5-(3H-indol-2-ylsulfanyl)furan-2-yl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 162118981) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is ethane;(5Z)-5-[[5-(3H-indol-2-ylsulfanyl)furan-2-yl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | ethane;(5Z)-5-[[5-(3H-indol-2-ylsulfanyl)furan-2-yl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 162118981 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | ethane;(5Z)-5-[[5-(3H-indol-2-ylsulfanyl)furan-2-yl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CC.CN1C(=O)S/C(=C\c2ccc(SC3=Nc4ccccc4C3)o2)C1=O |
| InChI | InChI=1S/C17H12N2O3S2.C2H6/c1-19-16(20)13(23-17(19)21)9-11-6-7-15(22-11)24-14-8-10-4-2-3-5-12(10)18-14;1-2/h2-7,9H,8H2,1H3;1-2H3/b13-9-; |
| InChIKey | ZHDRHPUPTGNANH-CHHCPSLASA-N |
| XLogP | 5.35 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|