C15H11NO3S — CID 59681883
(5Z)-3-methyl-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 59681883) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is (5Z)-3-methyl-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-methyl-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59681883 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | (5Z)-3-methyl-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)S/C(=C\c2ccc(-c3ccccc3)o2)C1=O |
| InChI | InChI=1S/C15H11NO3S/c1-16-14(17)13(20-15(16)18)9-11-7-8-12(19-11)10-5-3-2-4-6-10/h2-9H,1H3/b13-9- |
| InChIKey | OROAMDFMUMURRY-LCYFTJDESA-N |
| XLogP | 3.61 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|