C20H14N2O4S — CID 135948628
3-[[(5Z)-5-(2H-chromen-3-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 135948628) has the molecular formula C20H14N2O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is 3-[[(5Z)-5-(2H-chromen-3-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-(2H-chromen-3-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 135948628 |
| Molecular Formula | C20H14N2O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 3-[[(5Z)-5-(2H-chromen-3-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | O=C1N/C(=N\c2cccc(C(=O)O)c2)S/C1=C\C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C20H14N2O4S/c23-18-17(9-12-8-13-4-1-2-7-16(13)26-11-12)27-20(22-18)21-15-6-3-5-14(10-15)19(24)25/h1-10H,11H2,(H,24,25)(H,21,22,23)/b17-9- |
| InChIKey | VZWWHYMGYAMAQP-MFOYZWKCSA-N |
| XLogP | 3.60 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|