C19H14N2O6S — CID 135948629
3-[[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 135948629) has the molecular formula C19H14N2O6S and a molecular weight of 398.40 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 135948629 |
| Molecular Formula | C19H14N2O6S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 3-[[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | O=C(O)COc1ccc(/C=C2\S/C(=N/c3cccc(C(=O)O)c3)NC2=O)cc1 |
| InChI | InChI=1S/C19H14N2O6S/c22-16(23)10-27-14-6-4-11(5-7-14)8-15-17(24)21-19(28-15)20-13-3-1-2-12(9-13)18(25)26/h1-9H,10H2,(H,22,23)(H,25,26)(H,20,21,24)/b15-8- |
| InChIKey | LFTHMLZRVSHDCV-NVNXTCNLSA-N |
| XLogP | 2.74 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|