C18H13IN2O4S — CID 137062918
2-[4-[(E)-[2-(4-iodophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 137062918) has the molecular formula C18H13IN2O4S and a molecular weight of 480.28 g/mol. Its IUPAC name is 2-[4-[(E)-[2-(4-iodophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[2-(4-iodophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137062918 |
| Molecular Formula | C18H13IN2O4S |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 479.96 |
| IUPAC Name | 2-[4-[(E)-[2-(4-iodophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=C2/S/C(=N\c3ccc(I)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C18H13IN2O4S/c19-12-3-5-13(6-4-12)20-18-21-17(24)15(26-18)9-11-1-7-14(8-2-11)25-10-16(22)23/h1-9H,10H2,(H,22,23)(H,20,21,24)/b15-9+ |
| InChIKey | GJNVWPYORBVBQU-OQLLNIDSSA-N |
| XLogP | 3.65 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|