C12H12N4O2S — CID 80885957
N-methyl-6-(3-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine (PubChem CID 80885957) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is N-methyl-6-(3-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine.
| Compound Name | N-methyl-6-(3-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80885957 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-methyl-6-(3-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine |
| SMILES | CNc1ncnc(Sc2cccc(C)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O2S/c1-8-4-3-5-9(6-8)19-12-10(16(17)18)11(13-2)14-7-15-12/h3-7H,1-2H3,(H,13,14,15) |
| InChIKey | XROPIRNRPMQKSN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|