C11H9N3O4S2 — CID 114404763
methyl 6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyridine-2-carboxylate (PubChem CID 114404763) has the molecular formula C11H9N3O4S2 and a molecular weight of 311.34 g/mol. Its IUPAC name is methyl 6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyridine-2-carboxylate.
| Compound Name | methyl 6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyridine-2-carboxylate |
|---|---|
| PubChem CID | 114404763 |
| Molecular Formula | C11H9N3O4S2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | methyl 6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])c(Sc2nc(C)cs2)n1 |
| InChI | InChI=1S/C11H9N3O4S2/c1-6-5-19-11(12-6)20-9-8(14(16)17)4-3-7(13-9)10(15)18-2/h3-5H,1-2H3 |
| InChIKey | UFADCUJIJZJFSS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|