C12H12N2O3S2 — CID 78952061
(1R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]ethanol (PubChem CID 78952061) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (1R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]ethanol.
| Compound Name | (1R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]ethanol |
|---|---|
| PubChem CID | 78952061 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | (1R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]ethanol |
| SMILES | Cc1csc(Sc2ccc([C@@H](C)O)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H12N2O3S2/c1-7-6-18-12(13-7)19-11-4-3-9(8(2)15)5-10(11)14(16)17/h3-6,8,15H,1-2H3/t8-/m1/s1 |
| InChIKey | URZAVWNLOCJAEC-MRVPVSSYSA-N |
| XLogP | 3.56 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|