C10H9N3O3S2 — CID 55238144
(1R)-1-[3-nitro-4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]ethanol (PubChem CID 55238144) has the molecular formula C10H9N3O3S2 and a molecular weight of 283.33 g/mol. Its IUPAC name is (1R)-1-[3-nitro-4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]ethanol.
| Compound Name | (1R)-1-[3-nitro-4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 55238144 |
| Molecular Formula | C10H9N3O3S2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | (1R)-1-[3-nitro-4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(Sc2nncs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9N3O3S2/c1-6(14)7-2-3-9(8(4-7)13(15)16)18-10-12-11-5-17-10/h2-6,14H,1H3/t6-/m1/s1 |
| InChIKey | BKMPMSGROBCBAY-ZCFIWIBFSA-N |
| XLogP | 2.65 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|