C21H21N3O5S3 — CID 55551482
N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 55551482) has the molecular formula C21H21N3O5S3 and a molecular weight of 491.62 g/mol. Its IUPAC name is N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55551482 |
| Molecular Formula | C21H21N3O5S3 |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | Cc1csc(Sc2ccc(C(=O)N(C)C(C)c3ccc(S(C)(=O)=O)cc3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C21H21N3O5S3/c1-13-12-30-21(22-13)31-19-10-7-16(11-18(19)24(26)27)20(25)23(3)14(2)15-5-8-17(9-6-15)32(4,28)29/h5-12,14H,1-4H3 |
| InChIKey | BJVQFHNPSGLHHD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 110.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|