C7H8FN7OS — CID 80929228
3-(5-fluoro-2-hydrazinylpyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 80929228) has the molecular formula C7H8FN7OS and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-(5-fluoro-2-hydrazinylpyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(5-fluoro-2-hydrazinylpyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 80929228 |
| Molecular Formula | C7H8FN7OS |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3-(5-fluoro-2-hydrazinylpyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cn1c(Sc2nc(NN)ncc2F)n[nH]c1=O |
| InChI | InChI=1S/C7H8FN7OS/c1-15-6(16)13-14-7(15)17-4-3(8)2-10-5(11-4)12-9/h2H,9H2,1H3,(H,13,16)(H,10,11,12) |
| InChIKey | MLQUMKVCBSSWIM-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|