C11H8FN5S2 — CID 80925852
[4-(1,3-benzothiazol-2-ylsulfanyl)-5-fluoropyrimidin-2-yl]hydrazine (PubChem CID 80925852) has the molecular formula C11H8FN5S2 and a molecular weight of 293.35 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-ylsulfanyl)-5-fluoropyrimidin-2-yl]hydrazine.
| Compound Name | [4-(1,3-benzothiazol-2-ylsulfanyl)-5-fluoropyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80925852 |
| Molecular Formula | C11H8FN5S2 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | [4-(1,3-benzothiazol-2-ylsulfanyl)-5-fluoropyrimidin-2-yl]hydrazine |
| SMILES | NNc1ncc(F)c(Sc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C11H8FN5S2/c12-6-5-14-10(17-13)16-9(6)19-11-15-7-3-1-2-4-8(7)18-11/h1-5H,13H2,(H,14,16,17) |
| InChIKey | XJFHJMZGGOGTBH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|