C13H9FN2S2 — CID 60875381
3-(1,3-benzothiazol-2-ylsulfanyl)-5-fluoroaniline (PubChem CID 60875381) has the molecular formula C13H9FN2S2 and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)-5-fluoroaniline.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-5-fluoroaniline |
|---|---|
| PubChem CID | 60875381 |
| Molecular Formula | C13H9FN2S2 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-5-fluoroaniline |
| SMILES | Nc1cc(F)cc(Sc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C13H9FN2S2/c14-8-5-9(15)7-10(6-8)17-13-16-11-3-1-2-4-12(11)18-13/h1-7H,15H2 |
| InChIKey | HKBZQEMWOOHQNG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|